C21H30N3OS2+ — CID 4080890
3-(4-methoxyphenyl)-1-(3-piperidin-1-ium-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4080890) has the molecular formula C21H30N3OS2+ and a molecular weight of 404.63 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-(3-piperidin-1-ium-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-methoxyphenyl)-1-(3-piperidin-1-ium-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4080890 |
| Molecular Formula | C21H30N3OS2+ |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-(3-piperidin-1-ium-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCC[NH+]2CCCCC2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C21H29N3OS2/c1-25-19-10-8-18(9-11-19)22-21(26)24(17-20-7-5-16-27-20)15-6-14-23-12-3-2-4-13-23/h5,7-11,16H,2-4,6,12-15,17H2,1H3,(H,22,26)/p+1 |
| InChIKey | FHRGNLSZHKOTAT-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|