C21H29N3OS2 — CID 4276111
3-(2-methoxyphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4276111) has the molecular formula C21H29N3OS2 and a molecular weight of 403.62 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(2-methoxyphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4276111 |
| Molecular Formula | C21H29N3OS2 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-(3-piperidin-1-ylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N(CCCN1CCCCC1)Cc1cccs1 |
| InChI | InChI=1S/C21H29N3OS2/c1-25-20-11-4-3-10-19(20)22-21(26)24(17-18-9-7-16-27-18)15-8-14-23-12-5-2-6-13-23/h3-4,7,9-11,16H,2,5-6,8,12-15,17H2,1H3,(H,22,26) |
| InChIKey | GOPGGRDAPBSZEB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|