C21H29N3OS — CID 4152519
1-(furan-2-ylmethyl)-3-(2-methylphenyl)-1-(3-piperidin-1-ylpropyl)thiourea (PubChem CID 4152519) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-1-(3-piperidin-1-ylpropyl)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-1-(3-piperidin-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4152519 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(2-methylphenyl)-1-(3-piperidin-1-ylpropyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N(CCCN1CCCCC1)Cc1ccco1 |
| InChI | InChI=1S/C21H29N3OS/c1-18-9-3-4-11-20(18)22-21(26)24(17-19-10-7-16-25-19)15-8-14-23-12-5-2-6-13-23/h3-4,7,9-11,16H,2,5-6,8,12-15,17H2,1H3,(H,22,26) |
| InChIKey | FUQVHDRCAPOHNG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|