C22H31N3OS — CID 3626523
3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ylpropyl)thiourea (PubChem CID 3626523) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ylpropyl)thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3626523 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ylpropyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCCN2CCCCC2)Cc2ccco2)cc1C |
| InChI | InChI=1S/C22H31N3OS/c1-18-9-10-20(16-19(18)2)23-22(27)25(17-21-8-6-15-26-21)14-7-13-24-11-4-3-5-12-24/h6,8-10,15-16H,3-5,7,11-14,17H2,1-2H3,(H,23,27) |
| InChIKey | ZMYJVVDRBVHNTH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|