C18H17ClN2OS2 — CID 7988182
3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 7988182) has the molecular formula C18H17ClN2OS2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 7988182 |
| Molecular Formula | C18H17ClN2OS2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-(furan-2-ylmethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccco2)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C18H17ClN2OS2/c1-13-6-7-14(10-17(13)19)20-18(23)21(11-15-4-2-8-22-15)12-16-5-3-9-24-16/h2-10H,11-12H2,1H3,(H,20,23) |
| InChIKey | JTZWRLUOJITYHU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|