C19H19ClN2S3 — CID 8561785
3-(3-chloro-4-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 8561785) has the molecular formula C19H19ClN2S3 and a molecular weight of 407.03 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8561785 |
| Molecular Formula | C19H19ClN2S3 |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCc2cccs2)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C19H19ClN2S3/c1-14-6-7-15(12-18(14)20)21-19(23)22(13-17-5-3-11-25-17)9-8-16-4-2-10-24-16/h2-7,10-12H,8-9,13H2,1H3,(H,21,23) |
| InChIKey | DHVOJVWQDAJSDP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|