C18H26N3S2+ — CID 7943664
dimethyl-[3-[(3-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl]azanium (PubChem CID 7943664) has the molecular formula C18H26N3S2+ and a molecular weight of 348.56 g/mol. Its IUPAC name is dimethyl-[3-[(3-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl]azanium.
| Compound Name | dimethyl-[3-[(3-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 7943664 |
| Molecular Formula | C18H26N3S2+ |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | dimethyl-[3-[(3-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl]azanium |
| SMILES | Cc1cccc(NC(=S)N(CCC[NH+](C)C)Cc2cccs2)c1 |
| InChI | InChI=1S/C18H25N3S2/c1-15-7-4-8-16(13-15)19-18(22)21(11-6-10-20(2)3)14-17-9-5-12-23-17/h4-5,7-9,12-13H,6,10-11,14H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | ZFURFFXCNAERTJ-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|