C18H25N3S2 — CID 3507286
1-[2-(dimethylamino)ethyl]-3-(3,4-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3507286) has the molecular formula C18H25N3S2 and a molecular weight of 347.55 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-(3,4-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-(3,4-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3507286 |
| Molecular Formula | C18H25N3S2 |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-(3,4-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCN(C)C)Cc2cccs2)cc1C |
| InChI | InChI=1S/C18H25N3S2/c1-14-7-8-16(12-15(14)2)19-18(22)21(10-9-20(3)4)13-17-6-5-11-23-17/h5-8,11-12H,9-10,13H2,1-4H3,(H,19,22) |
| InChIKey | KLJGDXSPTVPDCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|