C19H20N2S3 — CID 8561767
3-(3-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 8561767) has the molecular formula C19H20N2S3 and a molecular weight of 372.58 g/mol. Its IUPAC name is 3-(3-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8561767 |
| Molecular Formula | C19H20N2S3 |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-(3-methylphenyl)-1-(2-thiophen-2-ylethyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(CCc2cccs2)Cc2cccs2)c1 |
| InChI | InChI=1S/C19H20N2S3/c1-15-5-2-6-16(13-15)20-19(22)21(14-18-8-4-12-24-18)10-9-17-7-3-11-23-17/h2-8,11-13H,9-10,14H2,1H3,(H,20,22) |
| InChIKey | QOPJOPJAEODXTJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|