C18H25ClN3S2+ — CID 8676254
3-[(3-chloro-4-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium (PubChem CID 8676254) has the molecular formula C18H25ClN3S2+ and a molecular weight of 383.01 g/mol. Its IUPAC name is 3-[(3-chloro-4-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(3-chloro-4-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8676254 |
| Molecular Formula | C18H25ClN3S2+ |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[(3-chloro-4-methylphenyl)carbamothioyl-(thiophen-2-ylmethyl)amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(NC(=S)N(CCC[NH+](C)C)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C18H24ClN3S2/c1-14-7-8-15(12-17(14)19)20-18(23)22(10-5-9-21(2)3)13-16-6-4-11-24-16/h4,6-8,11-12H,5,9-10,13H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | OXKRBRWDZCLQFF-UHFFFAOYSA-O |
| XLogP | 3.44 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|