C20H19ClN2S2 — CID 4168237
1-benzyl-3-(4-chloro-3-methylphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4168237) has the molecular formula C20H19ClN2S2 and a molecular weight of 386.97 g/mol. Its IUPAC name is 1-benzyl-3-(4-chloro-3-methylphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-(4-chloro-3-methylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4168237 |
| Molecular Formula | C20H19ClN2S2 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 1-benzyl-3-(4-chloro-3-methylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cc(NC(=S)N(Cc2ccccc2)Cc2cccs2)ccc1Cl |
| InChI | InChI=1S/C20H19ClN2S2/c1-15-12-17(9-10-19(15)21)22-20(24)23(14-18-8-5-11-25-18)13-16-6-3-2-4-7-16/h2-12H,13-14H2,1H3,(H,22,24) |
| InChIKey | HVYXNUXAQVAPRB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|