C21H20ClFN2S2 — CID 8727597
1-benzyl-3-(3-chloro-4-fluorophenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 8727597) has the molecular formula C21H20ClFN2S2 and a molecular weight of 418.99 g/mol. Its IUPAC name is 1-benzyl-3-(3-chloro-4-fluorophenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-benzyl-3-(3-chloro-4-fluorophenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8727597 |
| Molecular Formula | C21H20ClFN2S2 |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1-benzyl-3-(3-chloro-4-fluorophenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | C[C@@H](Cc1cccs1)N(Cc1ccccc1)C(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClFN2S2/c1-15(12-18-8-5-11-27-18)25(14-16-6-3-2-4-7-16)21(26)24-17-9-10-20(23)19(22)13-17/h2-11,13,15H,12,14H2,1H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | QEKUZQLLOOUSFI-HNNXBMFYSA-N |
| XLogP | 6.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|