C23H26N2S2 — CID 8658703
1-benzyl-3-(3,4-dimethylphenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea (PubChem CID 8658703) has the molecular formula C23H26N2S2 and a molecular weight of 394.61 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethylphenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea.
| Compound Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 8658703 |
| Molecular Formula | C23H26N2S2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[(2S)-1-thiophen-2-ylpropan-2-yl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccccc2)[C@@H](C)Cc2cccs2)cc1C |
| InChI | InChI=1S/C23H26N2S2/c1-17-11-12-21(14-18(17)2)24-23(26)25(16-20-8-5-4-6-9-20)19(3)15-22-10-7-13-27-22/h4-14,19H,15-16H2,1-3H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | KWCBEUSJCDFLAB-IBGZPJMESA-N |
| XLogP | 6.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|