C14H22N2S — CID 3787039
1-butan-2-yl-3-(3,4-dimethylphenyl)-1-methylthiourea (PubChem CID 3787039) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-butan-2-yl-3-(3,4-dimethylphenyl)-1-methylthiourea.
| Compound Name | 1-butan-2-yl-3-(3,4-dimethylphenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 3787039 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-butan-2-yl-3-(3,4-dimethylphenyl)-1-methylthiourea |
| SMILES | CCC(C)N(C)C(=S)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22N2S/c1-6-12(4)16(5)14(17)15-13-8-7-10(2)11(3)9-13/h7-9,12H,6H2,1-5H3,(H,15,17) |
| InChIKey | WLAKYIOETOWTEK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|