C15H22N2O2 — CID 108941829
N'-butan-2-yl-N-(3,4-dimethylphenyl)propanediamide (PubChem CID 108941829) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N'-butan-2-yl-N-(3,4-dimethylphenyl)propanediamide.
| Compound Name | N'-butan-2-yl-N-(3,4-dimethylphenyl)propanediamide |
|---|---|
| PubChem CID | 108941829 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N'-butan-2-yl-N-(3,4-dimethylphenyl)propanediamide |
| SMILES | CCC(C)NC(=O)CC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-5-12(4)16-14(18)9-15(19)17-13-7-6-10(2)11(3)8-13/h6-8,12H,5,9H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | NMPDEVQUABJGJE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|