C17H23ClN4O3 — CID 129441113
N'-[[4-[[(2R)-butan-2-yl]amino]-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide (PubChem CID 129441113) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is N'-[[4-[[(2R)-butan-2-yl]amino]-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide.
| Compound Name | N'-[[4-[[(2R)-butan-2-yl]amino]-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 129441113 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N'-[[4-[[(2R)-butan-2-yl]amino]-4-oxobutan-2-ylidene]amino]-N-(3-chloro-4-methylphenyl)oxamide |
| SMILES | CC[C@@H](C)NC(=O)CC(C)=NNC(=O)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C17H23ClN4O3/c1-5-11(3)19-15(23)8-12(4)21-22-17(25)16(24)20-13-7-6-10(2)14(18)9-13/h6-7,9,11H,5,8H2,1-4H3,(H,19,23)(H,20,24)(H,22,25)/t11-/m1/s1 |
| InChIKey | XQTVTRSDIKKKEI-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|