C13H15Cl2N3O2 — CID 546204
N-(3,4-dichlorophenyl)-3-(propanoylhydrazinylidene)butanamide (PubChem CID 546204) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(propanoylhydrazinylidene)butanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(propanoylhydrazinylidene)butanamide |
|---|---|
| PubChem CID | 546204 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(propanoylhydrazinylidene)butanamide |
| SMILES | CCC(=O)NN=C(C)CC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-3-12(19)18-17-8(2)6-13(20)16-9-4-5-10(14)11(15)7-9/h4-5,7H,3,6H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | OXPZSFLNRLOQSK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|