C17H25N3O2 — CID 3923948
N-[[4-(3,4-dimethylanilino)-4-oxobutan-2-ylidene]amino]pentanamide (PubChem CID 3923948) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[[4-(3,4-dimethylanilino)-4-oxobutan-2-ylidene]amino]pentanamide.
| Compound Name | N-[[4-(3,4-dimethylanilino)-4-oxobutan-2-ylidene]amino]pentanamide |
|---|---|
| PubChem CID | 3923948 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[[4-(3,4-dimethylanilino)-4-oxobutan-2-ylidene]amino]pentanamide |
| SMILES | CCCCC(=O)NN=C(C)CC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-5-6-7-16(21)20-19-14(4)11-17(22)18-15-9-8-12(2)13(3)10-15/h8-10H,5-7,11H2,1-4H3,(H,18,22)(H,20,21) |
| InChIKey | XIQWIPIFWYXXBK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|