C22H27N3O2 — CID 6122698
N-(3,4-dimethylphenyl)-N'-[(E)-1-phenylbutylideneamino]butanediamide (PubChem CID 6122698) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N'-[(E)-1-phenylbutylideneamino]butanediamide.
| Compound Name | N-(3,4-dimethylphenyl)-N'-[(E)-1-phenylbutylideneamino]butanediamide |
|---|---|
| PubChem CID | 6122698 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N'-[(E)-1-phenylbutylideneamino]butanediamide |
| SMILES | CCC/C(=N\NC(=O)CCC(=O)Nc1ccc(C)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-4-8-20(18-9-6-5-7-10-18)24-25-22(27)14-13-21(26)23-19-12-11-16(2)17(3)15-19/h5-7,9-12,15H,4,8,13-14H2,1-3H3,(H,23,26)(H,25,27)/b24-20+ |
| InChIKey | ADSCQPOUWFKRRD-HIXSDJFHSA-N |
| XLogP | 4.34 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|