C24H23N3O2 — CID 6367877
4-benzamido-N-[(E)-1-phenylbutylideneamino]benzamide (PubChem CID 6367877) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-benzamido-N-[(E)-1-phenylbutylideneamino]benzamide.
| Compound Name | 4-benzamido-N-[(E)-1-phenylbutylideneamino]benzamide |
|---|---|
| PubChem CID | 6367877 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-benzamido-N-[(E)-1-phenylbutylideneamino]benzamide |
| SMILES | CCC/C(=N\NC(=O)c1ccc(NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-2-9-22(18-10-5-3-6-11-18)26-27-24(29)20-14-16-21(17-15-20)25-23(28)19-12-7-4-8-13-19/h3-8,10-17H,2,9H2,1H3,(H,25,28)(H,27,29)/b26-22+ |
| InChIKey | UHATURBKYBGYFK-XTCLZLMSSA-N |
| XLogP | 4.87 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|