C24H31N3O2 — CID 4926193
4-(pentanoylamino)-N-(1-phenylhexylideneamino)benzamide (PubChem CID 4926193) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(pentanoylamino)-N-(1-phenylhexylideneamino)benzamide.
| Compound Name | 4-(pentanoylamino)-N-(1-phenylhexylideneamino)benzamide |
|---|---|
| PubChem CID | 4926193 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 4-(pentanoylamino)-N-(1-phenylhexylideneamino)benzamide |
| SMILES | CCCCCC(=NNC(=O)c1ccc(NC(=O)CCCC)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O2/c1-3-5-8-13-22(19-11-9-7-10-12-19)26-27-24(29)20-15-17-21(18-16-20)25-23(28)14-6-4-2/h7,9-12,15-18H,3-6,8,13-14H2,1-2H3,(H,25,28)(H,27,29) |
| InChIKey | RPRODHXQRDJJQL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|