C25H31N3O2 — CID 129437818
4-(octanoylamino)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide (PubChem CID 129437818) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-(octanoylamino)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide.
| Compound Name | 4-(octanoylamino)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 129437818 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 4-(octanoylamino)-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(C(=O)NN=C(C)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-3-4-5-6-10-13-24(29)26-23-18-16-22(17-19-23)25(30)28-27-20(2)14-15-21-11-8-7-9-12-21/h7-9,11-12,14-19H,3-6,10,13H2,1-2H3,(H,26,29)(H,28,30)/b15-14+,27-20? |
| InChIKey | BTGWRPVSEIVLKU-AJWWGKSFSA-N |
| XLogP | 5.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|