C27H36N2O2 — CID 51064208
4-decoxy-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide (PubChem CID 51064208) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-decoxy-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide.
| Compound Name | 4-decoxy-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 51064208 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 4-decoxy-N-[(E)-[(E)-4-phenylbut-3-en-2-ylidene]amino]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)N/N=C(C)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C27H36N2O2/c1-3-4-5-6-7-8-9-13-22-31-26-20-18-25(19-21-26)27(30)29-28-23(2)16-17-24-14-11-10-12-15-24/h10-12,14-21H,3-9,13,22H2,1-2H3,(H,29,30)/b17-16+,28-23+ |
| InChIKey | IKZMROJYQBACOE-OZXQKKSJSA-N |
| XLogP | 7.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|