C28H34N4O2 — CID 6321551
N,N'-bis[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]octanediamide (PubChem CID 6321551) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N,N'-bis[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]octanediamide.
| Compound Name | N,N'-bis[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]octanediamide |
|---|---|
| PubChem CID | 6321551 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N,N'-bis[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]octanediamide |
| SMILES | CC(/C=C/c1ccccc1)=N/NC(=O)CCCCCCC(=O)N/N=C(C)\C=C\c1ccccc1 |
| InChI | InChI=1S/C28H34N4O2/c1-23(19-21-25-13-7-5-8-14-25)29-31-27(33)17-11-3-4-12-18-28(34)32-30-24(2)20-22-26-15-9-6-10-16-26/h5-10,13-16,19-22H,3-4,11-12,17-18H2,1-2H3,(H,31,33)(H,32,34)/b21-19+,22-20+,29-23-,30-24- |
| InChIKey | IBVRVFSLMRAXPQ-SIGOQMLPSA-N |
| XLogP | 5.74 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|