C24H22N2O — CID 129431826
2,2-diphenyl-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide (PubChem CID 129431826) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 2,2-diphenyl-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide.
| Compound Name | 2,2-diphenyl-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide |
|---|---|
| PubChem CID | 129431826 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2,2-diphenyl-N-[[(E)-4-phenylbut-3-en-2-ylidene]amino]acetamide |
| SMILES | CC(/C=C/c1ccccc1)=NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O/c1-19(17-18-20-11-5-2-6-12-20)25-26-24(27)23(21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18,23H,1H3,(H,26,27)/b18-17+,25-19? |
| InChIKey | QBQTXFWRYFNSPJ-FQUMCYAQSA-N |
| XLogP | 5.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|