C21H22N4S — CID 5466074
1,3-bis[(E)-4-phenylbut-3-en-2-ylideneamino]thiourea (PubChem CID 5466074) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1,3-bis[(E)-4-phenylbut-3-en-2-ylideneamino]thiourea.
| Compound Name | 1,3-bis[(E)-4-phenylbut-3-en-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 5466074 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1,3-bis[(E)-4-phenylbut-3-en-2-ylideneamino]thiourea |
| SMILES | C/C(C=Cc1ccccc1)=N\NC(=S)N/N=C(\C)C=Cc1ccccc1 |
| InChI | InChI=1S/C21H22N4S/c1-17(13-15-19-9-5-3-6-10-19)22-24-21(26)25-23-18(2)14-16-20-11-7-4-8-12-20/h3-16H,1-2H3,(H2,24,25,26)/b15-13?,16-14?,22-17+,23-18+ |
| InChIKey | HUYRYEFQLRCGGD-IRHRULGRSA-N |
| XLogP | 4.63 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|