C18H18ClN3S — CID 6043094
1-(3-chloro-2-methylphenyl)-3-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]thiourea (PubChem CID 6043094) has the molecular formula C18H18ClN3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]thiourea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 6043094 |
| Molecular Formula | C18H18ClN3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]thiourea |
| SMILES | CC(/C=C/c1ccccc1)=N/NC(=S)Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C18H18ClN3S/c1-13(11-12-15-7-4-3-5-8-15)21-22-18(23)20-17-10-6-9-16(19)14(17)2/h3-12H,1-2H3,(H2,20,22,23)/b12-11+,21-13- |
| InChIKey | JPCLWMBCEMJGRH-CMBOEDIMSA-N |
| XLogP | 5.02 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|