C17H15ClN2OS — CID 905189
(E)-N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 905189) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is (E)-N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 905189 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (E)-N-[(3-chloro-2-methylphenyl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H15ClN2OS/c1-12-14(18)8-5-9-15(12)19-17(22)20-16(21)11-10-13-6-3-2-4-7-13/h2-11H,1H3,(H2,19,20,21,22)/b11-10+ |
| InChIKey | ZECDXOUDCHYBNM-ZHACJKMWSA-N |
| XLogP | 4.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|