C26H25N3O2 — CID 3384778
4-(butanoylamino)-N-(1,3-diphenylprop-2-enylideneamino)benzamide (PubChem CID 3384778) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(butanoylamino)-N-(1,3-diphenylprop-2-enylideneamino)benzamide.
| Compound Name | 4-(butanoylamino)-N-(1,3-diphenylprop-2-enylideneamino)benzamide |
|---|---|
| PubChem CID | 3384778 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-(butanoylamino)-N-(1,3-diphenylprop-2-enylideneamino)benzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NN=C(C=Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-2-9-25(30)27-23-17-15-22(16-18-23)26(31)29-28-24(21-12-7-4-8-13-21)19-14-20-10-5-3-6-11-20/h3-8,10-19H,2,9H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | SJGQLEPLVGFNPW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|