C29H29N3O2 — CID 6117901
N-[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]-4-(3-methylbutanoylamino)benzamide (PubChem CID 6117901) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]-4-(3-methylbutanoylamino)benzamide.
| Compound Name | N-[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]-4-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 6117901 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[[(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ylidene]amino]-4-(3-methylbutanoylamino)benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)NN=C(/C=C/c2ccccc2)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-22(2)21-28(33)30-26-19-15-25(16-20-26)29(34)32-31-27(17-13-23-9-5-3-6-10-23)18-14-24-11-7-4-8-12-24/h3-20,22H,21H2,1-2H3,(H,30,33)(H,32,34)/b17-13+,18-14+ |
| InChIKey | UYAUSFYKPULYDR-HBKJEHTGSA-N |
| XLogP | 6.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|