C22H18N2O — CID 3091818
N-(1,3-diphenylprop-2-enylideneamino)benzamide (PubChem CID 3091818) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(1,3-diphenylprop-2-enylideneamino)benzamide.
| Compound Name | N-(1,3-diphenylprop-2-enylideneamino)benzamide |
|---|---|
| PubChem CID | 3091818 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(1,3-diphenylprop-2-enylideneamino)benzamide |
| SMILES | O=C(NN=C(C=Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O/c25-22(20-14-8-3-9-15-20)24-23-21(19-12-6-2-7-13-19)17-16-18-10-4-1-5-11-18/h1-17H,(H,24,25) |
| InChIKey | HFXMSEOARJHWKQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|