C22H17ClN2O — CID 93028108
2-chloro-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]benzamide (PubChem CID 93028108) has the molecular formula C22H17ClN2O and a molecular weight of 360.84 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]benzamide.
| Compound Name | 2-chloro-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 93028108 |
| Molecular Formula | C22H17ClN2O |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-chloro-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]benzamide |
| SMILES | O=C(N/N=C(/C=C\c1ccccc1)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN2O/c23-20-14-8-7-13-19(20)22(26)25-24-21(18-11-5-2-6-12-18)16-15-17-9-3-1-4-10-17/h1-16H,(H,25,26)/b16-15-,24-21- |
| InChIKey | OEMMMQBGLXHVJT-YYRRSDCCSA-N |
| XLogP | 5.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|