C23H20N2O — CID 129460869
N-[[(E)-1,3-diphenylprop-2-enylidene]amino]-2-phenylacetamide (PubChem CID 129460869) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[[(E)-1,3-diphenylprop-2-enylidene]amino]-2-phenylacetamide.
| Compound Name | N-[[(E)-1,3-diphenylprop-2-enylidene]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 129460869 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[[(E)-1,3-diphenylprop-2-enylidene]amino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN=C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c26-23(18-20-12-6-2-7-13-20)25-24-22(21-14-8-3-9-15-21)17-16-19-10-4-1-5-11-19/h1-17H,18H2,(H,25,26)/b17-16+,24-22? |
| InChIKey | XPEGYXXDXSXAMG-OKTXNLSWSA-N |
| XLogP | 4.46 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|