C24H23N3O — CID 93046781
N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2-(2-methylanilino)acetamide (PubChem CID 93046781) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2-(2-methylanilino)acetamide.
| Compound Name | N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2-(2-methylanilino)acetamide |
|---|---|
| PubChem CID | 93046781 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2-(2-methylanilino)acetamide |
| SMILES | Cc1ccccc1NCC(=O)N/N=C(/C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O/c1-19-10-8-9-15-22(19)25-18-24(28)27-26-23(21-13-6-3-7-14-21)17-16-20-11-4-2-5-12-20/h2-17,25H,18H2,1H3,(H,27,28)/b17-16-,26-23- |
| InChIKey | QXBCVQSMBQDFHS-FJYFRMLDSA-N |
| XLogP | 4.64 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|