C18H18BrN3O — CID 126457936
N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-2-(2-methylanilino)acetamide (PubChem CID 126457936) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-2-(2-methylanilino)acetamide.
| Compound Name | N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-2-(2-methylanilino)acetamide |
|---|---|
| PubChem CID | 126457936 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-2-(2-methylanilino)acetamide |
| SMILES | Cc1ccccc1NCC(=O)N/N=C\C=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O/c1-14-5-2-3-7-17(14)20-13-18(23)22-21-12-4-6-15-8-10-16(19)11-9-15/h2-12,20H,13H2,1H3,(H,22,23)/b6-4+,21-12- |
| InChIKey | AGGJQSBAMIKHGL-PWXLJDLCSA-N |
| XLogP | 3.98 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|