C19H30N2O — CID 4676930
N-(1-phenylpentylideneamino)octanamide (PubChem CID 4676930) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-(1-phenylpentylideneamino)octanamide.
| Compound Name | N-(1-phenylpentylideneamino)octanamide |
|---|---|
| PubChem CID | 4676930 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-(1-phenylpentylideneamino)octanamide |
| SMILES | CCCCCCCC(=O)NN=C(CCCC)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O/c1-3-5-7-8-12-16-19(22)21-20-18(15-6-4-2)17-13-10-9-11-14-17/h9-11,13-14H,3-8,12,15-16H2,1-2H3,(H,21,22) |
| InChIKey | JGZPFNAVEYQMCN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|