C24H31N3O3 — CID 6392223
N-(4-ethoxyphenyl)-N'-[(E)-1-phenylhexylideneamino]butanediamide (PubChem CID 6392223) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N'-[(E)-1-phenylhexylideneamino]butanediamide.
| Compound Name | N-(4-ethoxyphenyl)-N'-[(E)-1-phenylhexylideneamino]butanediamide |
|---|---|
| PubChem CID | 6392223 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-(4-ethoxyphenyl)-N'-[(E)-1-phenylhexylideneamino]butanediamide |
| SMILES | CCCCC/C(=N\NC(=O)CCC(=O)Nc1ccc(OCC)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-5-7-12-22(19-10-8-6-9-11-19)26-27-24(29)18-17-23(28)25-20-13-15-21(16-14-20)30-4-2/h6,8-11,13-16H,3-5,7,12,17-18H2,1-2H3,(H,25,28)(H,27,29)/b26-22+ |
| InChIKey | LLVFZKSSZOGECM-XTCLZLMSSA-N |
| XLogP | 4.90 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|