C18H21N3O — CID 2838403
N-(1-phenylhexylideneamino)pyridine-4-carboxamide (PubChem CID 2838403) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(1-phenylhexylideneamino)pyridine-4-carboxamide.
| Compound Name | N-(1-phenylhexylideneamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2838403 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(1-phenylhexylideneamino)pyridine-4-carboxamide |
| SMILES | CCCCCC(=NNC(=O)c1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O/c1-2-3-5-10-17(15-8-6-4-7-9-15)20-21-18(22)16-11-13-19-14-12-16/h4,6-9,11-14H,2-3,5,10H2,1H3,(H,21,22) |
| InChIKey | SXFGWRXAAZVEHZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|