C26H27N3O2 — CID 3326267
3-methyl-N-[4-[(1-phenylpentylideneamino)carbamoyl]phenyl]benzamide (PubChem CID 3326267) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-methyl-N-[4-[(1-phenylpentylideneamino)carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[(1-phenylpentylideneamino)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3326267 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-methyl-N-[4-[(1-phenylpentylideneamino)carbamoyl]phenyl]benzamide |
| SMILES | CCCCC(=NNC(=O)c1ccc(NC(=O)c2cccc(C)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O2/c1-3-4-13-24(20-10-6-5-7-11-20)28-29-26(31)21-14-16-23(17-15-21)27-25(30)22-12-8-9-19(2)18-22/h5-12,14-18H,3-4,13H2,1-2H3,(H,27,30)(H,29,31) |
| InChIKey | DLGGNMSQOSWBMC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|