C17H25N3O4 — CID 6029887
N-[(Z)-[4-(2,5-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]pentanamide (PubChem CID 6029887) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(Z)-[4-(2,5-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]pentanamide.
| Compound Name | N-[(Z)-[4-(2,5-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]pentanamide |
|---|---|
| PubChem CID | 6029887 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[(Z)-[4-(2,5-dimethoxyanilino)-4-oxobutan-2-ylidene]amino]pentanamide |
| SMILES | CCCCC(=O)N/N=C(/C)CC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-5-6-7-16(21)20-19-12(2)10-17(22)18-14-11-13(23-3)8-9-15(14)24-4/h8-9,11H,5-7,10H2,1-4H3,(H,18,22)(H,20,21)/b19-12- |
| InChIKey | RLCWRXWZHYYBSX-UNOMPAQXSA-N |
| XLogP | 2.71 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|