C14H22N2O3 — CID 67149586
N-(2,5-dimethoxyphenyl)-4-(ethylamino)butanamide (PubChem CID 67149586) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-(ethylamino)butanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-(ethylamino)butanamide |
|---|---|
| PubChem CID | 67149586 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-(ethylamino)butanamide |
| SMILES | CCNCCCC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H22N2O3/c1-4-15-9-5-6-14(17)16-12-10-11(18-2)7-8-13(12)19-3/h7-8,10,15H,4-6,9H2,1-3H3,(H,16,17) |
| InChIKey | XQYFBJUVGPJDQB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|