C22H25N5O6 — CID 6064629
N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-(2,5-dimethoxyphenyl)oxamide (PubChem CID 6064629) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-(2,5-dimethoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-(2,5-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 6064629 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N'-[(Z)-[4-(2-acetamidoanilino)-4-oxobutan-2-ylidene]amino]-N-(2,5-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)N/N=C(/C)CC(=O)Nc2ccccc2NC(C)=O)c1 |
| InChI | InChI=1S/C22H25N5O6/c1-13(11-20(29)24-17-8-6-5-7-16(17)23-14(2)28)26-27-22(31)21(30)25-18-12-15(32-3)9-10-19(18)33-4/h5-10,12H,11H2,1-4H3,(H,23,28)(H,24,29)(H,25,30)(H,27,31)/b26-13- |
| InChIKey | QIZJFGPAADIRQU-ZMFRSBBQSA-N |
| XLogP | 2.12 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|