C20H21ClN4O5 — CID 3302269
N'-[[4-(5-chloro-2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyphenyl)oxamide (PubChem CID 3302269) has the molecular formula C20H21ClN4O5 and a molecular weight of 432.86 g/mol. Its IUPAC name is N'-[[4-(5-chloro-2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyphenyl)oxamide.
| Compound Name | N'-[[4-(5-chloro-2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 3302269 |
| Molecular Formula | C20H21ClN4O5 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N'-[[4-(5-chloro-2-methoxyanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyphenyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CC(C)=NNC(=O)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C20H21ClN4O5/c1-12(10-18(26)22-15-11-13(21)8-9-17(15)30-3)24-25-20(28)19(27)23-14-6-4-5-7-16(14)29-2/h4-9,11H,10H2,1-3H3,(H,22,26)(H,23,27)(H,25,28) |
| InChIKey | UVYQYLDDKBROPX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|