C16H13Cl2N3O3 — CID 5334540
N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2-methoxyphenyl)oxamide (PubChem CID 5334540) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2-methoxyphenyl)oxamide.
| Compound Name | N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 5334540 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N'-[(E)-(2,4-dichlorophenyl)methylideneamino]-N-(2-methoxyphenyl)oxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O3/c1-24-14-5-3-2-4-13(14)20-15(22)16(23)21-19-9-10-6-7-11(17)8-12(10)18/h2-9H,1H3,(H,20,22)(H,21,23)/b19-9+ |
| InChIKey | OZPCGKUYYINWKU-DJKKODMXSA-N |
| XLogP | 3.09 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|