C16H12Cl3N3O2 — CID 56698653
N-(5-chloro-2-methylphenyl)-N'-[(E)-(2,4-dichlorophenyl)methylideneamino]oxamide (PubChem CID 56698653) has the molecular formula C16H12Cl3N3O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-[(E)-(2,4-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-[(E)-(2,4-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 56698653 |
| Molecular Formula | C16H12Cl3N3O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-[(E)-(2,4-dichlorophenyl)methylideneamino]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3N3O2/c1-9-2-4-12(18)7-14(9)21-15(23)16(24)22-20-8-10-3-5-11(17)6-13(10)19/h2-8H,1H3,(H,21,23)(H,22,24)/b20-8+ |
| InChIKey | KOXXPVRCBXPLTB-DNTJNYDQSA-N |
| XLogP | 4.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|