C22H19Cl3N4O2 — CID 94836969
N-(5-chloro-2-methylphenyl)-N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide (PubChem CID 94836969) has the molecular formula C22H19Cl3N4O2 and a molecular weight of 477.78 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94836969 |
| Molecular Formula | C22H19Cl3N4O2 |
| Molecular Weight | 477.78 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]oxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=O)N/N=C\c1cc(C)n(-c2cccc(Cl)c2Cl)c1C |
| InChI | InChI=1S/C22H19Cl3N4O2/c1-12-7-8-16(23)10-18(12)27-21(30)22(31)28-26-11-15-9-13(2)29(14(15)3)19-6-4-5-17(24)20(19)25/h4-11H,1-3H3,(H,27,30)(H,28,31)/b26-11- |
| InChIKey | KKMSXHFURSNBGB-RAWMCFOBSA-N |
| XLogP | 5.45 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|