C25H20Cl2N4O2 — CID 94837169
N'-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-naphthalen-1-yloxamide (PubChem CID 94837169) has the molecular formula C25H20Cl2N4O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is N'-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-naphthalen-1-yloxamide.
| Compound Name | N'-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 94837169 |
| Molecular Formula | C25H20Cl2N4O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N'-[(Z)-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-naphthalen-1-yloxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)Nc2cccc3ccccc23)c(C)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H20Cl2N4O2/c1-15-12-18(16(2)31(15)23-11-10-19(26)13-21(23)27)14-28-30-25(33)24(32)29-22-9-5-7-17-6-3-4-8-20(17)22/h3-14H,1-2H3,(H,29,32)(H,30,33)/b28-14- |
| InChIKey | QGYDWMGAXNRPPS-MUXKCCDJSA-N |
| XLogP | 5.64 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|