C28H24Cl2N4O3 — CID 98058155
N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide (PubChem CID 98058155) has the molecular formula C28H24Cl2N4O3 and a molecular weight of 535.43 g/mol. Its IUPAC name is N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 98058155 |
| Molecular Formula | C28H24Cl2N4O3 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | N'-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-(4-phenylmethoxyphenyl)oxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)Nc2ccc(OCc3ccccc3)cc2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C28H24Cl2N4O3/c1-18-15-21(19(2)34(18)25-10-6-9-24(29)26(25)30)16-31-33-28(36)27(35)32-22-11-13-23(14-12-22)37-17-20-7-4-3-5-8-20/h3-16H,17H2,1-2H3,(H,32,35)(H,33,36)/b31-16- |
| InChIKey | PYJMCIOGYSLZKV-ACXHZZMFSA-N |
| XLogP | 6.07 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|