C28H23F3N4O3 — CID 94837077
N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide (PubChem CID 94837077) has the molecular formula C28H23F3N4O3 and a molecular weight of 520.51 g/mol. Its IUPAC name is N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94837077 |
| Molecular Formula | C28H23F3N4O3 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| SMILES | Cc1cc(/C=N\NC(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H23F3N4O3/c1-18-16-20(19(2)35(18)25-11-7-6-10-24(25)28(29,30)31)17-32-34-27(37)26(36)33-21-12-14-23(15-13-21)38-22-8-4-3-5-9-22/h3-17H,1-2H3,(H,33,36)(H,34,37)/b32-17- |
| InChIKey | SVGDUJBQCJNMLL-KYHGBAKBSA-N |
| XLogP | 5.99 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|