C23H20ClF3N4O3 — CID 94837120
N-(3-chloro-4-methoxyphenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide (PubChem CID 94837120) has the molecular formula C23H20ClF3N4O3 and a molecular weight of 492.89 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 94837120 |
| Molecular Formula | C23H20ClF3N4O3 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-[(Z)-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C\c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)cc1Cl |
| InChI | InChI=1S/C23H20ClF3N4O3/c1-13-10-15(14(2)31(13)19-7-5-4-6-17(19)23(25,26)27)12-28-30-22(33)21(32)29-16-8-9-20(34-3)18(24)11-16/h4-12H,1-3H3,(H,29,32)(H,30,33)/b28-12- |
| InChIKey | IZXXZGVYDZLLAZ-NVJOKUIPSA-N |
| XLogP | 4.86 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|